C17H24O — CID 141405483
4-[(1E,5E)-undeca-1,5-dienyl]phenol (PubChem CID 141405483) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-[(1E,5E)-undeca-1,5-dienyl]phenol.
| Compound Name | 4-[(1E,5E)-undeca-1,5-dienyl]phenol |
|---|---|
| PubChem CID | 141405483 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 4-[(1E,5E)-undeca-1,5-dienyl]phenol |
| SMILES | CCCCC/C=C/CC/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C17H24O/c1-2-3-4-5-6-7-8-9-10-11-16-12-14-17(18)15-13-16/h6-7,10-15,18H,2-5,8-9H2,1H3/b7-6+,11-10+ |
| InChIKey | DARONJKEXAFGBL-MVQNEBOGSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|