C17H26IN — CID 139765712
4-(9-iodonon-1-enyl)-N,N-dimethylaniline (PubChem CID 139765712) has the molecular formula C17H26IN and a molecular weight of 371.31 g/mol. Its IUPAC name is 4-(9-iodonon-1-enyl)-N,N-dimethylaniline.
| Compound Name | 4-(9-iodonon-1-enyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 139765712 |
| Molecular Formula | C17H26IN |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-(9-iodonon-1-enyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=CCCCCCCCI)cc1 |
| InChI | InChI=1S/C17H26IN/c1-19(2)17-13-11-16(12-14-17)10-8-6-4-3-5-7-9-15-18/h8,10-14H,3-7,9,15H2,1-2H3 |
| InChIKey | FHHYTHHUEXIDID-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|