C17H19N — CID 10728588
N,N-dimethyl-4-[(E)-3-phenylprop-1-enyl]aniline (PubChem CID 10728588) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-3-phenylprop-1-enyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-3-phenylprop-1-enyl]aniline |
|---|---|
| PubChem CID | 10728588 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N,N-dimethyl-4-[(E)-3-phenylprop-1-enyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N/c1-18(2)17-13-11-16(12-14-17)10-6-9-15-7-4-3-5-8-15/h3-8,10-14H,9H2,1-2H3/b10-6+ |
| InChIKey | LIQDESYGOCUKGN-UXBLZVDNSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|