About 3-phenylprop-1-enylbenzene;tetrahydrofluoride
3-phenylprop-1-enylbenzene;tetrahydrofluoride (PubChem CID 174822249) has the molecular formula C15H18F4
and a molecular weight of 274.30 g/mol. Its IUPAC name is 3-phenylprop-1-enylbenzene;tetrahydrofluoride.
Molecular Properties
| Compound Name | 3-phenylprop-1-enylbenzene;tetrahydrofluoride |
| PubChem CID | 174822249 |
| Molecular Formula | C15H18F4 |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-phenylprop-1-enylbenzene;tetrahydrofluoride |
| SMILES | C(=Cc1ccccc1)Cc1ccccc1.F.F.F.F |
| InChI | InChI=1S/C15H14.4FH/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;;;;/h1-12H,13H2;4*1H |
| InChIKey | SZEZOHBHZDTULL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-phenylprop-1-enylbenzene;tetrahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-1-enylbenzene;tetrahydrofluoride?
The IUPAC name of 3-phenylprop-1-enylbenzene;tetrahydrofluoride (CID 174822249) is 3-phenylprop-1-enylbenzene;tetrahydrofluoride.
What is the SMILES notation for 3-phenylprop-1-enylbenzene;tetrahydrofluoride?
The canonical SMILES for 3-phenylprop-1-enylbenzene;tetrahydrofluoride is C(=Cc1ccccc1)Cc1ccccc1.F.F.F.F.
What is the InChIKey of 3-phenylprop-1-enylbenzene;tetrahydrofluoride?
The InChIKey is SZEZOHBHZDTULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14.4FH/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;;;;/h1-12H,13H2;4*1H.
What are the key properties of 3-phenylprop-1-enylbenzene;tetrahydrofluoride?
3-phenylprop-1-enylbenzene;tetrahydrofluoride has a molecular weight of 274.30 g/mol, XLogP of 4.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-1-enylbenzene;tetrahydrofluoride is sourced from PubChem (CID 174822249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).