C18H19N — CID 10875699
N,N-dimethyl-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]aniline (PubChem CID 10875699) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 10875699 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N,N-dimethyl-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N/c1-19(2)18-14-12-17(13-15-18)11-7-6-10-16-8-4-3-5-9-16/h3-15H,1-2H3/b10-6+,11-7+ |
| InChIKey | PGKLKTNIWCOJEV-JMQWPVDRSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|