C21H27ClN2O4 — CID 173417054
CID 173417054 (PubChem CID 173417054) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol.
| Compound Name | CID 173417054 |
|---|---|
| PubChem CID | 173417054 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc(C=CCC=Cc2ccc(N(C)C)cc2)cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C21H26N2.ClHO4/c1-22(2)20-14-10-18(11-15-20)8-6-5-7-9-19-12-16-21(17-13-19)23(3)4;2-1(3,4)5/h6-17H,5H2,1-4H3;(H,2,3,4,5) |
| InChIKey | NNMLCENOJAHYOD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|