C24H31ClN4O4 — CID 173423168
CID 173423168 (PubChem CID 173423168) has the molecular formula C24H31ClN4O4 and a molecular weight of 474.99 g/mol.
| Compound Name | CID 173423168 |
|---|---|
| PubChem CID | 173423168 |
| Molecular Formula | C24H31ClN4O4 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc(N(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C24H30N4.ClHO4/c1-25(2)19-7-13-22(14-8-19)28(23-15-9-20(10-16-23)26(3)4)24-17-11-21(12-18-24)27(5)6;2-1(3,4)5/h7-18H,1-6H3;(H,2,3,4,5) |
| InChIKey | RTVUHHJKJORRLY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|