About (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid
(2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid (PubChem CID 19853495) has the molecular formula C13H18ClNO5
and a molecular weight of 303.74 g/mol. Its IUPAC name is (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid.
Molecular Properties
| Compound Name | (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid |
| PubChem CID | 19853495 |
| Molecular Formula | C13H18ClNO5 |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid |
| SMILES | C=C/C=C/C(O)c1ccc(N(C)C)cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C13H17NO.ClHO4/c1-4-5-6-13(15)11-7-9-12(10-8-11)14(2)3;2-1(3,4)5/h4-10,13,15H,1H2,2-3H3;(H,2,3,4,5)/b6-5+; |
| InChIKey | ROBJUEHGQFYFNS-IPZCTEOASA-N |
| XLogP | -1.60 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid?
The IUPAC name of (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid (CID 19853495) is (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid.
What is the SMILES notation for (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid?
The canonical SMILES for (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid is C=C/C=C/C(O)c1ccc(N(C)C)cc1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid?
The InChIKey is ROBJUEHGQFYFNS-IPZCTEOASA-N. The full InChI is InChI=1S/C13H17NO.ClHO4/c1-4-5-6-13(15)11-7-9-12(10-8-11)14(2)3;2-1(3,4)5/h4-10,13,15H,1H2,2-3H3;(H,2,3,4,5)/b6-5+;.
What are the key properties of (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid?
(2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid has a molecular weight of 303.74 g/mol, XLogP of -1.60, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-[4-(dimethylamino)phenyl]penta-2,4-dien-1-ol;perchloric acid is sourced from PubChem (CID 19853495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).