C12H18N2 — CID 55270314
4-[(1S)-1-aminobut-3-enyl]-N,N-dimethylaniline (PubChem CID 55270314) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-[(1S)-1-aminobut-3-enyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1S)-1-aminobut-3-enyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 55270314 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-[(1S)-1-aminobut-3-enyl]-N,N-dimethylaniline |
| SMILES | C=CC[C@H](N)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C12H18N2/c1-4-5-12(13)10-6-8-11(9-7-10)14(2)3/h4,6-9,12H,1,5,13H2,2-3H3/t12-/m0/s1 |
| InChIKey | AFEKYIXJKIRATK-LBPRGKRZSA-N |
| XLogP | 2.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|