C20H23N — CID 71390388
N,N-dimethyl-4-(1-phenylhexa-1,5-dien-3-yl)aniline (PubChem CID 71390388) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N,N-dimethyl-4-(1-phenylhexa-1,5-dien-3-yl)aniline.
| Compound Name | N,N-dimethyl-4-(1-phenylhexa-1,5-dien-3-yl)aniline |
|---|---|
| PubChem CID | 71390388 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N,N-dimethyl-4-(1-phenylhexa-1,5-dien-3-yl)aniline |
| SMILES | C=CCC(C=Cc1ccccc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H23N/c1-4-8-18(12-11-17-9-6-5-7-10-17)19-13-15-20(16-14-19)21(2)3/h4-7,9-16,18H,1,8H2,2-3H3 |
| InChIKey | KYGLAKRWHZHOKC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|