C49H49N3 — CID 99649280
4-[(E)-2-[4-[bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]methyl]phenyl]ethenyl]-N,N-dimethylaniline (PubChem CID 99649280) has the molecular formula C49H49N3 and a molecular weight of 679.95 g/mol. Its IUPAC name is 4-[(E)-2-[4-[bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]methyl]phenyl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[4-[bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]methyl]phenyl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 99649280 |
| Molecular Formula | C49H49N3 |
| Molecular Weight | 679.95 g/mol |
| Exact Mass | 679.39 |
| IUPAC Name | 4-[(E)-2-[4-[bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]methyl]phenyl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(C(c3ccc(/C=C/c4ccc(N(C)C)cc4)cc3)c3ccc(/C=C/c4ccc(N(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C49H49N3/c1-50(2)46-31-19-40(20-32-46)10-7-37-13-25-43(26-14-37)49(44-27-15-38(16-28-44)8-11-41-21-33-47(34-22-41)51(3)4)45-29-17-39(18-30-45)9-12-42-23-35-48(36-24-42)52(5)6/h7-36,49H,1-6H3/b10-7+,11-8+,12-9+ |
| InChIKey | PXYAHJMFXOSNQX-SRDSWEMOSA-N |
| XLogP | 11.58 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.95 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|