C23H24Cl2N2 — CID 154612128
4-[(3,5-dichlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline (PubChem CID 154612128) has the molecular formula C23H24Cl2N2 and a molecular weight of 399.37 g/mol. Its IUPAC name is 4-[(3,5-dichlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(3,5-dichlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 154612128 |
| Molecular Formula | C23H24Cl2N2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-[(3,5-dichlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H24Cl2N2/c1-26(2)21-9-5-16(6-10-21)23(18-13-19(24)15-20(25)14-18)17-7-11-22(12-8-17)27(3)4/h5-15,23H,1-4H3 |
| InChIKey | INKOXAFMYRPSLH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|