C16H18ClN — CID 58923332
4-[1-(4-chlorophenyl)ethyl]-N,N-dimethylaniline (PubChem CID 58923332) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)ethyl]-N,N-dimethylaniline.
| Compound Name | 4-[1-(4-chlorophenyl)ethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 58923332 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-[1-(4-chlorophenyl)ethyl]-N,N-dimethylaniline |
| SMILES | CC(c1ccc(Cl)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H18ClN/c1-12(13-4-8-15(17)9-5-13)14-6-10-16(11-7-14)18(2)3/h4-12H,1-3H3 |
| InChIKey | HGNCYKNCONTJKG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|