C26H33N3 — CID 101099324
4-[4-(dimethylamino)phenyl]-2-[1-[4-(dimethylamino)phenyl]ethyl]-N,N-dimethylaniline (PubChem CID 101099324) has the molecular formula C26H33N3 and a molecular weight of 387.57 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-2-[1-[4-(dimethylamino)phenyl]ethyl]-N,N-dimethylaniline.
| Compound Name | 4-[4-(dimethylamino)phenyl]-2-[1-[4-(dimethylamino)phenyl]ethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101099324 |
| Molecular Formula | C26H33N3 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-2-[1-[4-(dimethylamino)phenyl]ethyl]-N,N-dimethylaniline |
| SMILES | CC(c1ccc(N(C)C)cc1)c1cc(-c2ccc(N(C)C)cc2)ccc1N(C)C |
| InChI | InChI=1S/C26H33N3/c1-19(20-8-13-23(14-9-20)27(2)3)25-18-22(12-17-26(25)29(6)7)21-10-15-24(16-11-21)28(4)5/h8-19H,1-7H3 |
| InChIKey | MBZZJZFYQZYQSS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|