C17H22N2 — CID 54911733
N,N-dimethyl-4-[4-[1-(methylamino)ethyl]phenyl]aniline (PubChem CID 54911733) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N,N-dimethyl-4-[4-[1-(methylamino)ethyl]phenyl]aniline.
| Compound Name | N,N-dimethyl-4-[4-[1-(methylamino)ethyl]phenyl]aniline |
|---|---|
| PubChem CID | 54911733 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N,N-dimethyl-4-[4-[1-(methylamino)ethyl]phenyl]aniline |
| SMILES | CNC(C)c1ccc(-c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C17H22N2/c1-13(18-2)14-5-7-15(8-6-14)16-9-11-17(12-10-16)19(3)4/h5-13,18H,1-4H3 |
| InChIKey | ZXNIJDVEBVIAGB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |