C16H20N2 — CID 115970393
N,N-dimethyl-4-[methylamino(phenyl)methyl]aniline (PubChem CID 115970393) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N,N-dimethyl-4-[methylamino(phenyl)methyl]aniline.
| Compound Name | N,N-dimethyl-4-[methylamino(phenyl)methyl]aniline |
|---|---|
| PubChem CID | 115970393 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N,N-dimethyl-4-[methylamino(phenyl)methyl]aniline |
| SMILES | CNC(c1ccccc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H20N2/c1-17-16(13-7-5-4-6-8-13)14-9-11-15(12-10-14)18(2)3/h4-12,16-17H,1-3H3 |
| InChIKey | MORMINGHVVGKJK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|