C16H17F3N2 — CID 105146542
N,N-dimethyl-4-[methylamino-(2,3,4-trifluorophenyl)methyl]aniline (PubChem CID 105146542) has the molecular formula C16H17F3N2 and a molecular weight of 294.32 g/mol. Its IUPAC name is N,N-dimethyl-4-[methylamino-(2,3,4-trifluorophenyl)methyl]aniline.
| Compound Name | N,N-dimethyl-4-[methylamino-(2,3,4-trifluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 105146542 |
| Molecular Formula | C16H17F3N2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N,N-dimethyl-4-[methylamino-(2,3,4-trifluorophenyl)methyl]aniline |
| SMILES | CNC(c1ccc(N(C)C)cc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H17F3N2/c1-20-16(10-4-6-11(7-5-10)21(2)3)12-8-9-13(17)15(19)14(12)18/h4-9,16,20H,1-3H3 |
| InChIKey | VHFUGPPQVBXIEF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|