C15H14F3NO — CID 62963769
1-(2-methoxyphenyl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine (PubChem CID 62963769) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | 1-(2-methoxyphenyl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 62963769 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-(2-methoxyphenyl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine |
| SMILES | CNC(c1ccccc1OC)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H14F3NO/c1-19-15(9-5-3-4-6-12(9)20-2)10-7-8-11(16)14(18)13(10)17/h3-8,15,19H,1-2H3 |
| InChIKey | FFBKHSFIXMLNMJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|