C15H13BrF3NO — CID 107539013
1-(2-bromo-3,4-difluorophenyl)-1-(5-fluoro-2-methoxyphenyl)-N-methylmethanamine (PubChem CID 107539013) has the molecular formula C15H13BrF3NO and a molecular weight of 360.17 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-1-(5-fluoro-2-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-1-(5-fluoro-2-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107539013 |
| Molecular Formula | C15H13BrF3NO |
| Molecular Weight | 360.17 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-1-(5-fluoro-2-methoxyphenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(F)ccc1OC)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C15H13BrF3NO/c1-20-15(9-4-5-11(18)14(19)13(9)16)10-7-8(17)3-6-12(10)21-2/h3-7,15,20H,1-2H3 |
| InChIKey | MTZLNTJYBKBXHM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.17 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|