C15H15BrFNO — CID 43485696
1-(4-bromophenyl)-1-(5-fluoro-2-methoxyphenyl)-N-methylmethanamine (PubChem CID 43485696) has the molecular formula C15H15BrFNO and a molecular weight of 324.19 g/mol. Its IUPAC name is 1-(4-bromophenyl)-1-(5-fluoro-2-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromophenyl)-1-(5-fluoro-2-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 43485696 |
| Molecular Formula | C15H15BrFNO |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-(4-bromophenyl)-1-(5-fluoro-2-methoxyphenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Br)cc1)c1cc(F)ccc1OC |
| InChI | InChI=1S/C15H15BrFNO/c1-18-15(10-3-5-11(16)6-4-10)13-9-12(17)7-8-14(13)19-2/h3-9,15,18H,1-2H3 |
| InChIKey | HBAUPYQENYXKIA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |