C15H13F4N — CID 62965139
1-(4-fluoro-3-methylphenyl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine (PubChem CID 62965139) has the molecular formula C15H13F4N and a molecular weight of 283.27 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 62965139 |
| Molecular Formula | C15H13F4N |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-N-methyl-1-(2,3,4-trifluorophenyl)methanamine |
| SMILES | CNC(c1ccc(F)c(C)c1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H13F4N/c1-8-7-9(3-5-11(8)16)15(20-2)10-4-6-12(17)14(19)13(10)18/h3-7,15,20H,1-2H3 |
| InChIKey | IZRNCKJGZCEHEK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|