C21H20IN — CID 138551235
4-[(4-iodophenyl)-phenylmethyl]-N,N-dimethylaniline (PubChem CID 138551235) has the molecular formula C21H20IN and a molecular weight of 413.30 g/mol. Its IUPAC name is 4-[(4-iodophenyl)-phenylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(4-iodophenyl)-phenylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 138551235 |
| Molecular Formula | C21H20IN |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-[(4-iodophenyl)-phenylmethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2ccccc2)c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C21H20IN/c1-23(2)20-14-10-18(11-15-20)21(16-6-4-3-5-7-16)17-8-12-19(22)13-9-17/h3-15,21H,1-2H3 |
| InChIKey | TXCALZFSFNMTRX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|