C14H14IN3 — CID 577894
4-[(4-iodophenyl)diazenyl]-N,N-dimethylaniline (PubChem CID 577894) has the molecular formula C14H14IN3 and a molecular weight of 351.19 g/mol. Its IUPAC name is 4-[(4-iodophenyl)diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(4-iodophenyl)diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 577894 |
| Molecular Formula | C14H14IN3 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 4-[(4-iodophenyl)diazenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C14H14IN3/c1-18(2)14-9-7-13(8-10-14)17-16-12-5-3-11(15)4-6-12/h3-10H,1-2H3/b17-16+ |
| InChIKey | JSCFDMNXBTVUTH-WUKNDPDISA-N |
| XLogP | 4.77 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|