C16H16IN3 — CID 154979865
4-[(E)-[(E)-(4-iodophenyl)methylidenehydrazinylidene]methyl]-N,N-dimethylaniline (PubChem CID 154979865) has the molecular formula C16H16IN3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 4-[(E)-[(E)-(4-iodophenyl)methylidenehydrazinylidene]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-[(E)-(4-iodophenyl)methylidenehydrazinylidene]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 154979865 |
| Molecular Formula | C16H16IN3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 4-[(E)-[(E)-(4-iodophenyl)methylidenehydrazinylidene]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/N=C/c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C16H16IN3/c1-20(2)16-9-5-14(6-10-16)12-19-18-11-13-3-7-15(17)8-4-13/h3-12H,1-2H3/b18-11+,19-12+ |
| InChIKey | KPXBGFRJSVKUNJ-GDAWTGGTSA-N |
| XLogP | 3.81 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|