C9H11NO+ — CID 102273448
CID 102273448 (PubChem CID 102273448) has the molecular formula C9H11NO+ and a molecular weight of 149.19 g/mol.
| Compound Name | CID 102273448 |
|---|---|
| PubChem CID | 102273448 |
| Molecular Formula | C9H11NO+ |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc(C=[O+])cc1 |
| InChI | InChI=1S/C9H11NO/c1-10(2)9-5-3-8(7-11)4-6-9/h3-7H,1-2H3/q+1 |
| InChIKey | UKWUBCOXLSRKLQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 23.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|