C20H32N2 — CID 91522137
4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline;ethane (PubChem CID 91522137) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline;ethane.
| Compound Name | 4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline;ethane |
|---|---|
| PubChem CID | 91522137 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-N,N-dimethylaniline;ethane |
| SMILES | CC.CC.CN(C)c1ccc(-c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C16H20N2.2C2H6/c1-17(2)15-9-5-13(6-10-15)14-7-11-16(12-8-14)18(3)4;2*1-2/h5-12H,1-4H3;2*1-2H3 |
| InChIKey | LQTRJSBBZVQIRM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |