C14H14ClN — CID 2757476
4-(4-chlorophenyl)-N,N-dimethylaniline (PubChem CID 2757476) has the molecular formula C14H14ClN and a molecular weight of 231.73 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N,N-dimethylaniline.
| Compound Name | 4-(4-chlorophenyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 2757476 |
| Molecular Formula | C14H14ClN |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-(4-chlorophenyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H14ClN/c1-16(2)14-9-5-12(6-10-14)11-3-7-13(15)8-4-11/h3-10H,1-2H3 |
| InChIKey | VSIMGMGRBSMTBE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |