C12H8Cl2Ru — CID 159976594
1-chloro-4-(4-chlorophenyl)benzene;ruthenium (PubChem CID 159976594) has the molecular formula C12H8Cl2Ru and a molecular weight of 324.17 g/mol. Its IUPAC name is 1-chloro-4-(4-chlorophenyl)benzene;ruthenium.
| Compound Name | 1-chloro-4-(4-chlorophenyl)benzene;ruthenium |
|---|---|
| PubChem CID | 159976594 |
| Molecular Formula | C12H8Cl2Ru |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | 1-chloro-4-(4-chlorophenyl)benzene;ruthenium |
| SMILES | Clc1ccc(-c2ccc(Cl)cc2)cc1.[Ru] |
| InChI | InChI=1S/C12H8Cl2.Ru/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;/h1-8H; |
| InChIKey | OFFUMGSTQVWXTH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |