C15H15F2N — CID 132579488
4-[4-(difluoromethyl)phenyl]-N,N-dimethylaniline (PubChem CID 132579488) has the molecular formula C15H15F2N and a molecular weight of 247.29 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)phenyl]-N,N-dimethylaniline.
| Compound Name | 4-[4-(difluoromethyl)phenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 132579488 |
| Molecular Formula | C15H15F2N |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-[4-(difluoromethyl)phenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2ccc(C(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H15F2N/c1-18(2)14-9-7-12(8-10-14)11-3-5-13(6-4-11)15(16)17/h3-10,15H,1-2H3 |
| InChIKey | AGDIVEARXWZFLT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |