C11H15F2N — CID 154791327
4-(difluoromethyl)-N,N-diethylaniline (PubChem CID 154791327) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is 4-(difluoromethyl)-N,N-diethylaniline.
| Compound Name | 4-(difluoromethyl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 154791327 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 4-(difluoromethyl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C11H15F2N/c1-3-14(4-2)10-7-5-9(6-8-10)11(12)13/h5-8,11H,3-4H2,1-2H3 |
| InChIKey | JKHLBDKLADSUHW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |