C13H20ClF3N2 — CID 171227547
4-[(1S)-1-amino-3,3,3-trifluoropropyl]-N,N-diethylaniline;hydrochloride (PubChem CID 171227547) has the molecular formula C13H20ClF3N2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 4-[(1S)-1-amino-3,3,3-trifluoropropyl]-N,N-diethylaniline;hydrochloride.
| Compound Name | 4-[(1S)-1-amino-3,3,3-trifluoropropyl]-N,N-diethylaniline;hydrochloride |
|---|---|
| PubChem CID | 171227547 |
| Molecular Formula | C13H20ClF3N2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-[(1S)-1-amino-3,3,3-trifluoropropyl]-N,N-diethylaniline;hydrochloride |
| SMILES | CCN(CC)c1ccc([C@@H](N)CC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C13H19F3N2.ClH/c1-3-18(4-2)11-7-5-10(6-8-11)12(17)9-13(14,15)16;/h5-8,12H,3-4,9,17H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | IAHKARJONGXPGK-YDALLXLXSA-N |
| XLogP | 3.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|