C12H19FN2 — CID 171227521
4-[(1R)-1-amino-2-fluoroethyl]-N,N-diethylaniline (PubChem CID 171227521) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2-fluoroethyl]-N,N-diethylaniline.
| Compound Name | 4-[(1R)-1-amino-2-fluoroethyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 171227521 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 4-[(1R)-1-amino-2-fluoroethyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc([C@@H](N)CF)cc1 |
| InChI | InChI=1S/C12H19FN2/c1-3-15(4-2)11-7-5-10(6-8-11)12(14)9-13/h5-8,12H,3-4,9,14H2,1-2H3/t12-/m0/s1 |
| InChIKey | KYHKTWOMFWKPJB-LBPRGKRZSA-N |
| XLogP | 2.50 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|