C14H25ClN2 — CID 70262837
1-N,1-N,4-N,4-N-tetraethylbenzene-1,4-diamine;hydrochloride (PubChem CID 70262837) has the molecular formula C14H25ClN2 and a molecular weight of 256.82 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N-tetraethylbenzene-1,4-diamine;hydrochloride.
| Compound Name | 1-N,1-N,4-N,4-N-tetraethylbenzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 70262837 |
| Molecular Formula | C14H25ClN2 |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetraethylbenzene-1,4-diamine;hydrochloride |
| SMILES | CCN(CC)c1ccc(N(CC)CC)cc1.Cl |
| InChI | InChI=1S/C14H24N2.ClH/c1-5-15(6-2)13-9-11-14(12-10-13)16(7-3)8-4;/h9-12H,5-8H2,1-4H3;1H |
| InChIKey | KKEZASPKGXAHOI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|