C12H18ClN — CID 67541310
4-ethenyl-N,N-diethylaniline;hydrochloride (PubChem CID 67541310) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is 4-ethenyl-N,N-diethylaniline;hydrochloride.
| Compound Name | 4-ethenyl-N,N-diethylaniline;hydrochloride |
|---|---|
| PubChem CID | 67541310 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-ethenyl-N,N-diethylaniline;hydrochloride |
| SMILES | C=Cc1ccc(N(CC)CC)cc1.Cl |
| InChI | InChI=1S/C12H17N.ClH/c1-4-11-7-9-12(10-8-11)13(5-2)6-3;/h4,7-10H,1,5-6H2,2-3H3;1H |
| InChIKey | KJCJEIVPKSGGQA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|