C31H48N2O — CID 158914965
4-(dibutylamino)benzaldehyde;N,N-dibutyl-4-ethenylaniline (PubChem CID 158914965) has the molecular formula C31H48N2O and a molecular weight of 464.74 g/mol. Its IUPAC name is 4-(dibutylamino)benzaldehyde;N,N-dibutyl-4-ethenylaniline.
| Compound Name | 4-(dibutylamino)benzaldehyde;N,N-dibutyl-4-ethenylaniline |
|---|---|
| PubChem CID | 158914965 |
| Molecular Formula | C31H48N2O |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.38 |
| IUPAC Name | 4-(dibutylamino)benzaldehyde;N,N-dibutyl-4-ethenylaniline |
| SMILES | C=Cc1ccc(N(CCCC)CCCC)cc1.CCCCN(CCCC)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C16H25N.C15H23NO/c1-4-7-13-17(14-8-5-2)16-11-9-15(6-3)10-12-16;1-3-5-11-16(12-6-4-2)15-9-7-14(13-17)8-10-15/h6,9-12H,3-5,7-8,13-14H2,1-2H3;7-10,13H,3-6,11-12H2,1-2H3 |
| InChIKey | JHCSLUKYYQJTOZ-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|