C24H45NO6Si2 — CID 23067785
4-ethenyl-N,N-bis(2-triethoxysilylethyl)aniline (PubChem CID 23067785) has the molecular formula C24H45NO6Si2 and a molecular weight of 499.80 g/mol. Its IUPAC name is 4-ethenyl-N,N-bis(2-triethoxysilylethyl)aniline.
| Compound Name | 4-ethenyl-N,N-bis(2-triethoxysilylethyl)aniline |
|---|---|
| PubChem CID | 23067785 |
| Molecular Formula | C24H45NO6Si2 |
| Molecular Weight | 499.80 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 4-ethenyl-N,N-bis(2-triethoxysilylethyl)aniline |
| SMILES | C=Cc1ccc(N(CC[Si](OCC)(OCC)OCC)CC[Si](OCC)(OCC)OCC)cc1 |
| InChI | InChI=1S/C24H45NO6Si2/c1-8-23-15-17-24(18-16-23)25(19-21-32(26-9-2,27-10-3)28-11-4)20-22-33(29-12-5,30-13-6)31-14-7/h8,15-18H,1,9-14,19-22H2,2-7H3 |
| InChIKey | MDMSRUGLJSSRHL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.80 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|