About ethene;ethoxy(trihydroxy)silane;styrene
ethene;ethoxy(trihydroxy)silane;styrene (PubChem CID 174819091) has the molecular formula C12H20O4Si
and a molecular weight of 256.37 g/mol. Its IUPAC name is ethene;ethoxy(trihydroxy)silane;styrene.
Molecular Properties
| Compound Name | ethene;ethoxy(trihydroxy)silane;styrene |
| PubChem CID | 174819091 |
| Molecular Formula | C12H20O4Si |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | ethene;ethoxy(trihydroxy)silane;styrene |
| SMILES | C=C.C=Cc1ccccc1.CCO[Si](O)(O)O |
| InChI | InChI=1S/C8H8.C2H8O4Si.C2H4/c1-2-8-6-4-3-5-7-8;1-2-6-7(3,4)5;1-2/h2-7H,1H2;3-5H,2H2,1H3;1-2H2 |
| InChIKey | AMYSKJANEZYSRM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;ethoxy(trihydroxy)silane;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;ethoxy(trihydroxy)silane;styrene?
The IUPAC name of ethene;ethoxy(trihydroxy)silane;styrene (CID 174819091) is ethene;ethoxy(trihydroxy)silane;styrene.
What is the SMILES notation for ethene;ethoxy(trihydroxy)silane;styrene?
The canonical SMILES for ethene;ethoxy(trihydroxy)silane;styrene is C=C.C=Cc1ccccc1.CCO[Si](O)(O)O.
What is the InChIKey of ethene;ethoxy(trihydroxy)silane;styrene?
The InChIKey is AMYSKJANEZYSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C2H8O4Si.C2H4/c1-2-8-6-4-3-5-7-8;1-2-6-7(3,4)5;1-2/h2-7H,1H2;3-5H,2H2,1H3;1-2H2.
What are the key properties of ethene;ethoxy(trihydroxy)silane;styrene?
ethene;ethoxy(trihydroxy)silane;styrene has a molecular weight of 256.37 g/mol, XLogP of 1.57, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;ethoxy(trihydroxy)silane;styrene is sourced from PubChem (CID 174819091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).