C17H26 — CID 161435264
butane;2-methylbuta-1,3-diene;styrene (PubChem CID 161435264) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is butane;2-methylbuta-1,3-diene;styrene.
| Compound Name | butane;2-methylbuta-1,3-diene;styrene |
|---|---|
| PubChem CID | 161435264 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | butane;2-methylbuta-1,3-diene;styrene |
| SMILES | C=CC(=C)C.C=Cc1ccccc1.CCCC |
| InChI | InChI=1S/C8H8.C5H8.C4H10/c1-2-8-6-4-3-5-7-8;1-4-5(2)3;1-3-4-2/h2-7H,1H2;4H,1-2H2,3H3;3-4H2,1-2H3 |
| InChIKey | VYOHKJSIPXUYJD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|