C18H22 — CID 174829799
2-methylbuta-1,3-diene;penta-1,2,4-triene;styrene (PubChem CID 174829799) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;penta-1,2,4-triene;styrene.
| Compound Name | 2-methylbuta-1,3-diene;penta-1,2,4-triene;styrene |
|---|---|
| PubChem CID | 174829799 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-methylbuta-1,3-diene;penta-1,2,4-triene;styrene |
| SMILES | C=C=CC=C.C=CC(=C)C.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C5H8.C5H6/c1-2-8-6-4-3-5-7-8;1-4-5(2)3;1-3-5-4-2/h2-7H,1H2;4H,1-2H2,3H3;3,5H,1-2H2 |
| InChIKey | VBTZZZYHSIULTF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|