About 2-chlorobuta-1,3-diene;styrene
2-chlorobuta-1,3-diene;styrene (PubChem CID 146314687) has the molecular formula C20H21Cl
and a molecular weight of 296.84 g/mol. Its IUPAC name is 2-chlorobuta-1,3-diene;styrene.
Molecular Properties
| Compound Name | 2-chlorobuta-1,3-diene;styrene |
| PubChem CID | 146314687 |
| Molecular Formula | C20H21Cl |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-chlorobuta-1,3-diene;styrene |
| SMILES | C=CC(=C)Cl.C=Cc1ccccc1.C=Cc1ccccc1 |
| InChI | InChI=1S/2C8H8.C4H5Cl/c2*1-2-8-6-4-3-5-7-8;1-3-4(2)5/h2*2-7H,1H2;3H,1-2H2 |
| InChIKey | YIHPYABTOROGAW-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobuta-1,3-diene;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobuta-1,3-diene;styrene?
The IUPAC name of 2-chlorobuta-1,3-diene;styrene (CID 146314687) is 2-chlorobuta-1,3-diene;styrene.
What is the SMILES notation for 2-chlorobuta-1,3-diene;styrene?
The canonical SMILES for 2-chlorobuta-1,3-diene;styrene is C=CC(=C)Cl.C=Cc1ccccc1.C=Cc1ccccc1.
What is the InChIKey of 2-chlorobuta-1,3-diene;styrene?
The InChIKey is YIHPYABTOROGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H8.C4H5Cl/c2*1-2-8-6-4-3-5-7-8;1-3-4(2)5/h2*2-7H,1H2;3H,1-2H2.
What are the key properties of 2-chlorobuta-1,3-diene;styrene?
2-chlorobuta-1,3-diene;styrene has a molecular weight of 296.84 g/mol, XLogP of 6.58, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobuta-1,3-diene;styrene is sourced from PubChem (CID 146314687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).