C12H8Cl6 — CID 174642952
1,1,2,3,4,4-hexachlorobuta-1,3-diene;styrene (PubChem CID 174642952) has the molecular formula C12H8Cl6 and a molecular weight of 364.91 g/mol. Its IUPAC name is 1,1,2,3,4,4-hexachlorobuta-1,3-diene;styrene.
| Compound Name | 1,1,2,3,4,4-hexachlorobuta-1,3-diene;styrene |
|---|---|
| PubChem CID | 174642952 |
| Molecular Formula | C12H8Cl6 |
| Molecular Weight | 364.91 g/mol |
| Exact Mass | 361.88 |
| IUPAC Name | 1,1,2,3,4,4-hexachlorobuta-1,3-diene;styrene |
| SMILES | C=Cc1ccccc1.ClC(Cl)=C(Cl)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C8H8.C4Cl6/c1-2-8-6-4-3-5-7-8;5-1(3(7)8)2(6)4(9)10/h2-7H,1H2; |
| InChIKey | HPGWVUMXLXRTAE-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.91 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|