C15H20O — CID 175188083
2-methylbuta-1,3-diene;oxirane;styrene (PubChem CID 175188083) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;oxirane;styrene.
| Compound Name | 2-methylbuta-1,3-diene;oxirane;styrene |
|---|---|
| PubChem CID | 175188083 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-methylbuta-1,3-diene;oxirane;styrene |
| SMILES | C1CO1.C=CC(=C)C.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C5H8.C2H4O/c1-2-8-6-4-3-5-7-8;1-4-5(2)3;1-2-3-1/h2-7H,1H2;4H,1-2H2,3H3;1-2H2 |
| InChIKey | CSKJERPYXOMEBO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|