C18H33NO6Si2 — CID 66815318
4-ethenyl-N,N-bis(2-trimethoxysilylethyl)aniline (PubChem CID 66815318) has the molecular formula C18H33NO6Si2 and a molecular weight of 415.64 g/mol. Its IUPAC name is 4-ethenyl-N,N-bis(2-trimethoxysilylethyl)aniline.
| Compound Name | 4-ethenyl-N,N-bis(2-trimethoxysilylethyl)aniline |
|---|---|
| PubChem CID | 66815318 |
| Molecular Formula | C18H33NO6Si2 |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 4-ethenyl-N,N-bis(2-trimethoxysilylethyl)aniline |
| SMILES | C=Cc1ccc(N(CC[Si](OC)(OC)OC)CC[Si](OC)(OC)OC)cc1 |
| InChI | InChI=1S/C18H33NO6Si2/c1-8-17-9-11-18(12-10-17)19(13-15-26(20-2,21-3)22-4)14-16-27(23-5,24-6)25-7/h8-12H,1,13-16H2,2-7H3 |
| InChIKey | OQAOTKJWJRQUBW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|