C18H32N2O3Si — CID 151323239
N'-[2-(4-ethenylphenyl)ethyl]-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 151323239) has the molecular formula C18H32N2O3Si and a molecular weight of 352.55 g/mol. Its IUPAC name is N'-[2-(4-ethenylphenyl)ethyl]-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[2-(4-ethenylphenyl)ethyl]-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 151323239 |
| Molecular Formula | C18H32N2O3Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N'-[2-(4-ethenylphenyl)ethyl]-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | C=Cc1ccc(CCNCCNCCC[Si](OC)(OC)OC)cc1 |
| InChI | InChI=1S/C18H32N2O3Si/c1-5-17-7-9-18(10-8-17)11-13-20-15-14-19-12-6-16-24(21-2,22-3)23-4/h5,7-10,19-20H,1,6,11-16H2,2-4H3 |
| InChIKey | OGXDIDGQRMMLDY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|