C20H54N6O6Si2 — CID 159586592
N'-[2-(3-trimethoxysilylpropylamino)ethyl]ethane-1,2-diamine (PubChem CID 159586592) has the molecular formula C20H54N6O6Si2 and a molecular weight of 530.86 g/mol. Its IUPAC name is N'-[2-(3-trimethoxysilylpropylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(3-trimethoxysilylpropylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 159586592 |
| Molecular Formula | C20H54N6O6Si2 |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | N'-[2-(3-trimethoxysilylpropylamino)ethyl]ethane-1,2-diamine |
| SMILES | CO[Si](CCCNCCNCCN)(OC)OC.CO[Si](CCCNCCNCCN)(OC)OC |
| InChI | InChI=1S/2C10H27N3O3Si/c2*1-14-17(15-2,16-3)10-4-6-12-8-9-13-7-5-11/h2*12-13H,4-11H2,1-3H3 |
| InChIKey | MJRSPVBOOTUYTK-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 155.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|