C13H34N4O3Si — CID 134961256
N-methyl-N'-[2-[2-(3-trimethoxysilylpropylamino)ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 134961256) has the molecular formula C13H34N4O3Si and a molecular weight of 322.53 g/mol. Its IUPAC name is N-methyl-N'-[2-[2-(3-trimethoxysilylpropylamino)ethylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[2-[2-(3-trimethoxysilylpropylamino)ethylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 134961256 |
| Molecular Formula | C13H34N4O3Si |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-methyl-N'-[2-[2-(3-trimethoxysilylpropylamino)ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | CNCCNCCNCCNCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H34N4O3Si/c1-14-7-8-16-11-12-17-10-9-15-6-5-13-21(18-2,19-3)20-4/h14-17H,5-13H2,1-4H3 |
| InChIKey | XOLRFMBRNRIBSM-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 75.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|