C10H25N3O4Si — CID 58846540
1-[2-(methylamino)ethyl]-3-(3-trimethoxysilylpropyl)urea (PubChem CID 58846540) has the molecular formula C10H25N3O4Si and a molecular weight of 279.41 g/mol. Its IUPAC name is 1-[2-(methylamino)ethyl]-3-(3-trimethoxysilylpropyl)urea.
| Compound Name | 1-[2-(methylamino)ethyl]-3-(3-trimethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 58846540 |
| Molecular Formula | C10H25N3O4Si |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-[2-(methylamino)ethyl]-3-(3-trimethoxysilylpropyl)urea |
| SMILES | CNCCNC(=O)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H25N3O4Si/c1-11-7-8-13-10(14)12-6-5-9-18(15-2,16-3)17-4/h11H,5-9H2,1-4H3,(H2,12,13,14) |
| InChIKey | KPGJKTILOZFTPJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|