C25H58N6O12Si3 — CID 20743189
3-(3-trimethoxysilylpropyl)-1,1-bis[2-(3-trimethoxysilylpropylcarbamoylamino)ethyl]urea (PubChem CID 20743189) has the molecular formula C25H58N6O12Si3 and a molecular weight of 719.03 g/mol. Its IUPAC name is 3-(3-trimethoxysilylpropyl)-1,1-bis[2-(3-trimethoxysilylpropylcarbamoylamino)ethyl]urea.
| Compound Name | 3-(3-trimethoxysilylpropyl)-1,1-bis[2-(3-trimethoxysilylpropylcarbamoylamino)ethyl]urea |
|---|---|
| PubChem CID | 20743189 |
| Molecular Formula | C25H58N6O12Si3 |
| Molecular Weight | 719.03 g/mol |
| Exact Mass | 718.34 |
| IUPAC Name | 3-(3-trimethoxysilylpropyl)-1,1-bis[2-(3-trimethoxysilylpropylcarbamoylamino)ethyl]urea |
| SMILES | CO[Si](CCCNC(=O)NCCN(CCNC(=O)NCCC[Si](OC)(OC)OC)C(=O)NCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C25H58N6O12Si3/c1-35-44(36-2,37-3)20-10-13-26-23(32)28-16-18-31(25(34)30-15-12-22-46(41-7,42-8)43-9)19-17-29-24(33)27-14-11-21-45(38-4,39-5)40-6/h10-22H2,1-9H3,(H,30,34)(H2,26,28,32)(H2,27,29,33) |
| InChIKey | PNGSFJSEQJTPQZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 197.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.03 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|