C14H32N2O8Si2 — CID 122383973
N,N'-bis(3-trimethoxysilylpropyl)oxamide (PubChem CID 122383973) has the molecular formula C14H32N2O8Si2 and a molecular weight of 412.59 g/mol. Its IUPAC name is N,N'-bis(3-trimethoxysilylpropyl)oxamide.
| Compound Name | N,N'-bis(3-trimethoxysilylpropyl)oxamide |
|---|---|
| PubChem CID | 122383973 |
| Molecular Formula | C14H32N2O8Si2 |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N,N'-bis(3-trimethoxysilylpropyl)oxamide |
| SMILES | CO[Si](CCCNC(=O)C(=O)NCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C14H32N2O8Si2/c1-19-25(20-2,21-3)11-7-9-15-13(17)14(18)16-10-8-12-26(22-4,23-5)24-6/h7-12H2,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | UFRSLDGJMFNEEE-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|