C11H28N2O4Si — CID 175097855
propan-2-one;N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 175097855) has the molecular formula C11H28N2O4Si and a molecular weight of 280.44 g/mol. Its IUPAC name is propan-2-one;N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | propan-2-one;N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 175097855 |
| Molecular Formula | C11H28N2O4Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | propan-2-one;N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)=O.CO[Si](CCCNCCN)(OC)OC |
| InChI | InChI=1S/C8H22N2O3Si.C3H6O/c1-11-14(12-2,13-3)8-4-6-10-7-5-9;1-3(2)4/h10H,4-9H2,1-3H3;1-2H3 |
| InChIKey | WQPRKMSBHQPMOU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|